C13H18N2 — CID 166995280
(4E,5E)-4,5-di(ethylidene)-2-[(2E,4Z)-hexa-2,4-dien-2-yl]-1H-imidazole (PubChem CID 166995280) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)-2-[(2E,4Z)-hexa-2,4-dien-2-yl]-1H-imidazole.
| Compound Name | (4E,5E)-4,5-di(ethylidene)-2-[(2E,4Z)-hexa-2,4-dien-2-yl]-1H-imidazole |
|---|---|
| PubChem CID | 166995280 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)-2-[(2E,4Z)-hexa-2,4-dien-2-yl]-1H-imidazole |
| SMILES | C/C=C\C=C(/C)c1nc(=C/C)/c(=C\C)[nH]1 |
| InChI | InChI=1S/C13H18N2/c1-5-8-9-10(4)13-14-11(6-2)12(7-3)15-13/h5-9H,1-4H3,(H,14,15)/b8-5-,10-9+,11-6+,12-7+ |
| InChIKey | CLRBCHQGDFDLRF-WSKPKWQYSA-N |
| XLogP | 1.99 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|