C10H19NS — CID 166995405
(7Z)-5-propan-2-yl-3,4,6,9-tetrahydro-2H-1,5-thiazonine (PubChem CID 166995405) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is (7Z)-5-propan-2-yl-3,4,6,9-tetrahydro-2H-1,5-thiazonine.
| Compound Name | (7Z)-5-propan-2-yl-3,4,6,9-tetrahydro-2H-1,5-thiazonine |
|---|---|
| PubChem CID | 166995405 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (7Z)-5-propan-2-yl-3,4,6,9-tetrahydro-2H-1,5-thiazonine |
| SMILES | CC(C)N1C/C=C\CSCCC1 |
| InChI | InChI=1S/C10H19NS/c1-10(2)11-6-3-4-8-12-9-5-7-11/h3-4,10H,5-9H2,1-2H3/b4-3- |
| InChIKey | QHYDFMZEXAEGSM-ARJAWSKDSA-N |
| XLogP | 2.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|