C18H32FNO — CID 166995825
(E)-N-[3-(1-fluorocyclopropyl)propyl]-5-[(3S)-3,4,5-trimethyloxolan-2-yl]pent-4-en-1-amine (PubChem CID 166995825) has the molecular formula C18H32FNO and a molecular weight of 297.46 g/mol. Its IUPAC name is (E)-N-[3-(1-fluorocyclopropyl)propyl]-5-[(3S)-3,4,5-trimethyloxolan-2-yl]pent-4-en-1-amine.
| Compound Name | (E)-N-[3-(1-fluorocyclopropyl)propyl]-5-[(3S)-3,4,5-trimethyloxolan-2-yl]pent-4-en-1-amine |
|---|---|
| PubChem CID | 166995825 |
| Molecular Formula | C18H32FNO |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (E)-N-[3-(1-fluorocyclopropyl)propyl]-5-[(3S)-3,4,5-trimethyloxolan-2-yl]pent-4-en-1-amine |
| SMILES | CC1OC(/C=C/CCCNCCCC2(F)CC2)[C@@H](C)C1C |
| InChI | InChI=1S/C18H32FNO/c1-14-15(2)17(21-16(14)3)8-5-4-6-12-20-13-7-9-18(19)10-11-18/h5,8,14-17,20H,4,6-7,9-13H2,1-3H3/b8-5+/t14?,15-,16?,17?/m0/s1 |
| InChIKey | GFGPFSCJLDQLKP-OPOUTLCLSA-N |
| XLogP | 4.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|