C45H87N5 — CID 166996422
9-[6-(1-tert-butylazetidin-3-yl)-3-(4-tert-butylpiperidin-1-yl)-3,6-dimethylheptyl]-2,2,3,3,8,8,9-heptamethyl-1,4,7-triazatricyclo[8.2.2.24,7]hexadecane (PubChem CID 166996422) has the molecular formula C45H87N5 and a molecular weight of 698.23 g/mol. Its IUPAC name is 9-[6-(1-tert-butylazetidin-3-yl)-3-(4-tert-butylpiperidin-1-yl)-3,6-dimethylheptyl]-2,2,3,3,8,8,9-heptamethyl-1,4,7-triazatricyclo[8.2.2.24,7]hexadecane.
| Compound Name | 9-[6-(1-tert-butylazetidin-3-yl)-3-(4-tert-butylpiperidin-1-yl)-3,6-dimethylheptyl]-2,2,3,3,8,8,9-heptamethyl-1,4,7-triazatricyclo[8.2.2.24,7]hexadecane |
|---|---|
| PubChem CID | 166996422 |
| Molecular Formula | C45H87N5 |
| Molecular Weight | 698.23 g/mol |
| Exact Mass | 697.70 |
| IUPAC Name | 9-[6-(1-tert-butylazetidin-3-yl)-3-(4-tert-butylpiperidin-1-yl)-3,6-dimethylheptyl]-2,2,3,3,8,8,9-heptamethyl-1,4,7-triazatricyclo[8.2.2.24,7]hexadecane |
| SMILES | CC(C)(C)C1CCN(C(C)(CCC(C)(C)C2CN(C(C)(C)C)C2)CCC2(C)C3CCN(CC3)C(C)(C)C(C)(C)N3CCN(CC3)C2(C)C)CC1 |
| InChI | InChI=1S/C45H87N5/c1-38(2,3)35-17-27-49(28-18-35)44(15,22-21-40(7,8)37-33-50(34-37)39(4,5)6)23-24-45(16)36-19-25-46(26-20-36)41(9,10)42(11,12)47-29-31-48(32-30-47)43(45,13)14/h35-37H,17-34H2,1-16H3 |
| InChIKey | JPTBSLWQEBKEHF-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 16.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.23 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |