C17H31NO — CID 166996468
(2R)-2-[(3E,5Z)-4-tert-butylhepta-1,3,5-trien-2-yl]oxy-N-propan-2-ylpropan-1-amine (PubChem CID 166996468) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is (2R)-2-[(3E,5Z)-4-tert-butylhepta-1,3,5-trien-2-yl]oxy-N-propan-2-ylpropan-1-amine.
| Compound Name | (2R)-2-[(3E,5Z)-4-tert-butylhepta-1,3,5-trien-2-yl]oxy-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 166996468 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (2R)-2-[(3E,5Z)-4-tert-butylhepta-1,3,5-trien-2-yl]oxy-N-propan-2-ylpropan-1-amine |
| SMILES | C=C(/C=C(\C=C/C)C(C)(C)C)O[C@H](C)CNC(C)C |
| InChI | InChI=1S/C17H31NO/c1-9-10-16(17(6,7)8)11-14(4)19-15(5)12-18-13(2)3/h9-11,13,15,18H,4,12H2,1-3,5-8H3/b10-9-,16-11+/t15-/m1/s1 |
| InChIKey | PIKNMUBJQZOSFK-BTIJZVSDSA-N |
| XLogP | 4.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|