C21H38N2 — CID 166996568
(Z,4Z)-N-tert-butyl-7-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-4-ethylideneoct-5-en-1-amine (PubChem CID 166996568) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is (Z,4Z)-N-tert-butyl-7-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-4-ethylideneoct-5-en-1-amine.
| Compound Name | (Z,4Z)-N-tert-butyl-7-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-4-ethylideneoct-5-en-1-amine |
|---|---|
| PubChem CID | 166996568 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | (Z,4Z)-N-tert-butyl-7-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-4-ethylideneoct-5-en-1-amine |
| SMILES | C/C=C(\C=C/C(C)=N/C(=C\C)C(C)(C)C)CCCNC(C)(C)C |
| InChI | InChI=1S/C21H38N2/c1-10-18(13-12-16-22-21(7,8)9)15-14-17(3)23-19(11-2)20(4,5)6/h10-11,14-15,22H,12-13,16H2,1-9H3/b15-14-,18-10-,19-11-,23-17+ |
| InChIKey | RXEXOVUCEHQLDA-HWCJGYSLSA-N |
| XLogP | 6.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|