C22H39N3 — CID 166996572
3,3,4,4,11,11,12-heptamethyl-2,5,10-triazapentacyclo[11.3.1.15,9.02,15.07,10]octadecane (PubChem CID 166996572) has the molecular formula C22H39N3 and a molecular weight of 345.58 g/mol. Its IUPAC name is 3,3,4,4,11,11,12-heptamethyl-2,5,10-triazapentacyclo[11.3.1.15,9.02,15.07,10]octadecane.
| Compound Name | 3,3,4,4,11,11,12-heptamethyl-2,5,10-triazapentacyclo[11.3.1.15,9.02,15.07,10]octadecane |
|---|---|
| PubChem CID | 166996572 |
| Molecular Formula | C22H39N3 |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 345.31 |
| IUPAC Name | 3,3,4,4,11,11,12-heptamethyl-2,5,10-triazapentacyclo[11.3.1.15,9.02,15.07,10]octadecane |
| SMILES | CC1C2CC3CC(C2)N3C(C)(C)C(C)(C)N2CC3CC(C2)N3C1(C)C |
| InChI | InChI=1S/C22H39N3/c1-14-15-8-16-10-17(9-15)25(16)22(6,7)21(4,5)23-12-18-11-19(13-23)24(18)20(14,2)3/h14-19H,8-13H2,1-7H3 |
| InChIKey | LXNSRGHBBXCCPF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |