C23H41N3 — CID 166996651
3,4,4,11,11,12,12-heptamethyl-2,5,13-triazapentacyclo[11.4.1.15,9.02,15.07,10]nonadecane (PubChem CID 166996651) has the molecular formula C23H41N3 and a molecular weight of 359.60 g/mol. Its IUPAC name is 3,4,4,11,11,12,12-heptamethyl-2,5,13-triazapentacyclo[11.4.1.15,9.02,15.07,10]nonadecane.
| Compound Name | 3,4,4,11,11,12,12-heptamethyl-2,5,13-triazapentacyclo[11.4.1.15,9.02,15.07,10]nonadecane |
|---|---|
| PubChem CID | 166996651 |
| Molecular Formula | C23H41N3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.33 |
| IUPAC Name | 3,4,4,11,11,12,12-heptamethyl-2,5,13-triazapentacyclo[11.4.1.15,9.02,15.07,10]nonadecane |
| SMILES | CC1N2C3CCC2CN(C3)C(C)(C)C(C)(C)C2C3CC2CN(C3)C1(C)C |
| InChI | InChI=1S/C23H41N3/c1-15-22(4,5)24-11-16-10-17(12-24)20(16)21(2,3)23(6,7)25-13-18-8-9-19(14-25)26(15)18/h15-20H,8-14H2,1-7H3 |
| InChIKey | CJQBALGFUKWQCC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |