C18H31NO — CID 166996737
N-tert-butyl-3-[(2E,4Z)-5-ethenylocta-2,4-dien-3-yl]oxycyclobutan-1-amine (PubChem CID 166996737) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is N-tert-butyl-3-[(2E,4Z)-5-ethenylocta-2,4-dien-3-yl]oxycyclobutan-1-amine.
| Compound Name | N-tert-butyl-3-[(2E,4Z)-5-ethenylocta-2,4-dien-3-yl]oxycyclobutan-1-amine |
|---|---|
| PubChem CID | 166996737 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | N-tert-butyl-3-[(2E,4Z)-5-ethenylocta-2,4-dien-3-yl]oxycyclobutan-1-amine |
| SMILES | C=C/C(=C\C(=C/C)OC1CC(NC(C)(C)C)C1)CCC |
| InChI | InChI=1S/C18H31NO/c1-7-10-14(8-2)11-16(9-3)20-17-12-15(13-17)19-18(4,5)6/h8-9,11,15,17,19H,2,7,10,12-13H2,1,3-6H3/b14-11+,16-9+ |
| InChIKey | RFGUEEVFOGQSAX-CBYOLGTLSA-N |
| XLogP | 4.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|