C19H33NO — CID 166996742
N-ethyl-3-[(3Z,5Z)-5-ethylidene-8,8-dimethylnona-1,3-dien-2-yl]oxycyclobutan-1-amine (PubChem CID 166996742) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is N-ethyl-3-[(3Z,5Z)-5-ethylidene-8,8-dimethylnona-1,3-dien-2-yl]oxycyclobutan-1-amine.
| Compound Name | N-ethyl-3-[(3Z,5Z)-5-ethylidene-8,8-dimethylnona-1,3-dien-2-yl]oxycyclobutan-1-amine |
|---|---|
| PubChem CID | 166996742 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | N-ethyl-3-[(3Z,5Z)-5-ethylidene-8,8-dimethylnona-1,3-dien-2-yl]oxycyclobutan-1-amine |
| SMILES | C=C(/C=C\C(=C/C)CCC(C)(C)C)OC1CC(NCC)C1 |
| InChI | InChI=1S/C19H33NO/c1-7-16(11-12-19(4,5)6)10-9-15(3)21-18-13-17(14-18)20-8-2/h7,9-10,17-18,20H,3,8,11-14H2,1-2,4-6H3/b10-9-,16-7+ |
| InChIKey | KSJRMOYRGXIFRR-ZWNLQZFLSA-N |
| XLogP | 4.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|