About 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline
4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline (PubChem CID 166997537) has the molecular formula C22H19N
and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline.
Molecular Properties
| Compound Name | 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline |
| PubChem CID | 166997537 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline |
| SMILES | Nc1ccc(C2C=C(c3ccccc3)C=C3C=CC=CC32)cc1 |
| InChI | InChI=1S/C22H19N/c23-20-12-10-17(11-13-20)22-15-19(16-6-2-1-3-7-16)14-18-8-4-5-9-21(18)22/h1-15,21-22H,23H2 |
| InChIKey | PHTSNASEENYROC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline?
The IUPAC name of 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline (CID 166997537) is 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline.
What is the SMILES notation for 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline?
The canonical SMILES for 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline is Nc1ccc(C2C=C(c3ccccc3)C=C3C=CC=CC32)cc1.
What is the InChIKey of 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline?
The InChIKey is PHTSNASEENYROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N/c23-20-12-10-17(11-13-20)22-15-19(16-6-2-1-3-7-16)14-18-8-4-5-9-21(18)22/h1-15,21-22H,23H2.
What are the key properties of 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline?
4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline has a molecular weight of 297.40 g/mol, XLogP of 5.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-phenyl-1,8a-dihydronaphthalen-1-yl)aniline is sourced from PubChem (CID 166997537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).