C68H66N2 — CID 166997870
9,9-dimethyl-N-[4-[9-(4-methylphenyl)-6-[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]carbazol-3-yl]phenyl]-N-(4-phenylphenyl)-5,6-dihydrofluoren-2-amine (PubChem CID 166997870) has the molecular formula C68H66N2 and a molecular weight of 911.29 g/mol. Its IUPAC name is 9,9-dimethyl-N-[4-[9-(4-methylphenyl)-6-[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]carbazol-3-yl]phenyl]-N-(4-phenylphenyl)-5,6-dihydrofluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-[4-[9-(4-methylphenyl)-6-[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]carbazol-3-yl]phenyl]-N-(4-phenylphenyl)-5,6-dihydrofluoren-2-amine |
|---|---|
| PubChem CID | 166997870 |
| Molecular Formula | C68H66N2 |
| Molecular Weight | 911.29 g/mol |
| Exact Mass | 910.52 |
| IUPAC Name | 9,9-dimethyl-N-[4-[9-(4-methylphenyl)-6-[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]carbazol-3-yl]phenyl]-N-(4-phenylphenyl)-5,6-dihydrofluoren-2-amine |
| SMILES | Cc1ccc(-n2c3ccc(-c4ccc(C(CC(C)(C)C)C(C)(C)C)cc4)cc3c3cc(-c4ccc(N(c5ccc(-c6ccccc6)cc5)c5ccc6c(c5)C(C)(C)C5=C6CCC=C5)cc4)ccc32)cc1 |
| InChI | InChI=1S/C68H66N2/c1-45-19-31-55(32-20-45)70-64-39-29-51(48-21-23-50(24-22-48)63(67(5,6)7)44-66(2,3)4)41-59(64)60-42-52(30-40-65(60)70)49-27-35-54(36-28-49)69(53-33-25-47(26-34-53)46-15-11-10-12-16-46)56-37-38-58-57-17-13-14-18-61(57)68(8,9)62(58)43-56/h10-12,14-16,18-43,63H,13,17,44H2,1-9H3 |
| InChIKey | BIJFDFLQGAMFIT-UHFFFAOYSA-N |
| XLogP | 19.52 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.29 |
| LogP ≤ 5 | 19.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |