About N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine
N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine (PubChem CID 166999170) has the molecular formula C8H17N3
and a molecular weight of 155.24 g/mol. Its IUPAC name is N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine |
| PubChem CID | 166999170 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine |
| SMILES | C=CN(CCN(C)C)/N=C\C |
| InChI | InChI=1S/C8H17N3/c1-5-9-11(6-2)8-7-10(3)4/h5-6H,2,7-8H2,1,3-4H3/b9-5- |
| InChIKey | FXIDZIQRAAOKRX-UITAMQMPSA-N |
| XLogP | 1.00 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine?
The IUPAC name of N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine (CID 166999170) is N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine.
What is the SMILES notation for N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine?
The canonical SMILES for N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine is C=CN(CCN(C)C)/N=C\C.
What is the InChIKey of N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine?
The InChIKey is FXIDZIQRAAOKRX-UITAMQMPSA-N. The full InChI is InChI=1S/C8H17N3/c1-5-9-11(6-2)8-7-10(3)4/h5-6H,2,7-8H2,1,3-4H3/b9-5-.
What are the key properties of N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine?
N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine has a molecular weight of 155.24 g/mol, XLogP of 1.00, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethenyl-N'-[(Z)-ethylideneamino]-N,N-dimethylethane-1,2-diamine is sourced from PubChem (CID 166999170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).