C31H37N3O5S — CID 166999243
methyl (3S)-3-[[4-[(N-hydroxy-2,3,5,6-tetramethylanilino)sulfanyl-(2-methoxy-2-oxoethyl)amino]naphthalen-1-yl]-prop-2-ynylamino]butanoate (PubChem CID 166999243) has the molecular formula C31H37N3O5S and a molecular weight of 563.72 g/mol. Its IUPAC name is methyl (3S)-3-[[4-[(N-hydroxy-2,3,5,6-tetramethylanilino)sulfanyl-(2-methoxy-2-oxoethyl)amino]naphthalen-1-yl]-prop-2-ynylamino]butanoate.
| Compound Name | methyl (3S)-3-[[4-[(N-hydroxy-2,3,5,6-tetramethylanilino)sulfanyl-(2-methoxy-2-oxoethyl)amino]naphthalen-1-yl]-prop-2-ynylamino]butanoate |
|---|---|
| PubChem CID | 166999243 |
| Molecular Formula | C31H37N3O5S |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | methyl (3S)-3-[[4-[(N-hydroxy-2,3,5,6-tetramethylanilino)sulfanyl-(2-methoxy-2-oxoethyl)amino]naphthalen-1-yl]-prop-2-ynylamino]butanoate |
| SMILES | C#CCN(c1ccc(N(CC(=O)OC)SN(O)c2c(C)c(C)cc(C)c2C)c2ccccc12)[C@@H](C)CC(=O)OC |
| InChI | InChI=1S/C31H37N3O5S/c1-9-16-32(22(4)18-29(35)38-7)27-14-15-28(26-13-11-10-12-25(26)27)33(19-30(36)39-8)40-34(37)31-23(5)20(2)17-21(3)24(31)6/h1,10-15,17,22,37H,16,18-19H2,2-8H3/t22-/m0/s1 |
| InChIKey | GEMLFJVFEHTLLL-QFIPXVFZSA-N |
| XLogP | 5.90 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|