C20H15FN4O3 — CID 166999362
5-[5-[(1S)-2-[2-(3-fluorophenyl)ethynyl]cyclopropyl]-6-methoxypyridazin-3-yl]-1H-pyrimidine-2,4-dione (PubChem CID 166999362) has the molecular formula C20H15FN4O3 and a molecular weight of 378.36 g/mol. Its IUPAC name is 5-[5-[(1S)-2-[2-(3-fluorophenyl)ethynyl]cyclopropyl]-6-methoxypyridazin-3-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[5-[(1S)-2-[2-(3-fluorophenyl)ethynyl]cyclopropyl]-6-methoxypyridazin-3-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 166999362 |
| Molecular Formula | C20H15FN4O3 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 5-[5-[(1S)-2-[2-(3-fluorophenyl)ethynyl]cyclopropyl]-6-methoxypyridazin-3-yl]-1H-pyrimidine-2,4-dione |
| SMILES | COc1nnc(-c2c[nH]c(=O)[nH]c2=O)cc1[C@H]1CC1C#Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H15FN4O3/c1-28-19-15(9-17(24-25-19)16-10-22-20(27)23-18(16)26)14-8-12(14)6-5-11-3-2-4-13(21)7-11/h2-4,7,9-10,12,14H,8H2,1H3,(H2,22,23,26,27)/t12?,14-/m0/s1 |
| InChIKey | MBWJIHMKMHBTHD-PYMCNQPYSA-N |
| XLogP | 1.82 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|