C14H12N4O3 — CID 166999503
5-[5-[(1S,2S)-2-ethynylcyclopropyl]-6-methoxypyridazin-3-yl]-1H-pyrimidine-2,4-dione (PubChem CID 166999503) has the molecular formula C14H12N4O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 5-[5-[(1S,2S)-2-ethynylcyclopropyl]-6-methoxypyridazin-3-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[5-[(1S,2S)-2-ethynylcyclopropyl]-6-methoxypyridazin-3-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 166999503 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 5-[5-[(1S,2S)-2-ethynylcyclopropyl]-6-methoxypyridazin-3-yl]-1H-pyrimidine-2,4-dione |
| SMILES | C#C[C@H]1C[C@@H]1c1cc(-c2c[nH]c(=O)[nH]c2=O)nnc1OC |
| InChI | InChI=1S/C14H12N4O3/c1-3-7-4-8(7)9-5-11(17-18-13(9)21-2)10-6-15-14(20)16-12(10)19/h1,5-8H,4H2,2H3,(H2,15,16,19,20)/t7-,8-/m0/s1 |
| InChIKey | UHSMNCUWOGPELG-YUMQZZPRSA-N |
| XLogP | 0.27 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|