About 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine
3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine (PubChem CID 166999762) has the molecular formula C9H10Cl2N2
and a molecular weight of 217.10 g/mol. Its IUPAC name is 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine.
Molecular Properties
| Compound Name | 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine |
| PubChem CID | 166999762 |
| Molecular Formula | C9H10Cl2N2 |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine |
| SMILES | CC[C@H]1C[C@@H]1c1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C9H10Cl2N2/c1-2-5-3-6(5)7-4-8(10)12-13-9(7)11/h4-6H,2-3H2,1H3/t5-,6-/m0/s1 |
| InChIKey | FQTKRIQOAHNXOJ-WDSKDSINSA-N |
| XLogP | 3.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine?
The IUPAC name of 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine (CID 166999762) is 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine.
What is the SMILES notation for 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine?
The canonical SMILES for 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine is CC[C@H]1C[C@@H]1c1cc(Cl)nnc1Cl.
What is the InChIKey of 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine?
The InChIKey is FQTKRIQOAHNXOJ-WDSKDSINSA-N. The full InChI is InChI=1S/C9H10Cl2N2/c1-2-5-3-6(5)7-4-8(10)12-13-9(7)11/h4-6H,2-3H2,1H3/t5-,6-/m0/s1.
What are the key properties of 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine?
3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine has a molecular weight of 217.10 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloro-4-[(1S,2S)-2-ethylcyclopropyl]pyridazine is sourced from PubChem (CID 166999762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).