C11H22N4 — CID 166999986
(1E,3Z)-2-(aminomethyl)-4-methyl-5-methylimino-1-N-propan-2-ylpenta-1,3-diene-1,3-diamine (PubChem CID 166999986) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is (1E,3Z)-2-(aminomethyl)-4-methyl-5-methylimino-1-N-propan-2-ylpenta-1,3-diene-1,3-diamine.
| Compound Name | (1E,3Z)-2-(aminomethyl)-4-methyl-5-methylimino-1-N-propan-2-ylpenta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 166999986 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | (1E,3Z)-2-(aminomethyl)-4-methyl-5-methylimino-1-N-propan-2-ylpenta-1,3-diene-1,3-diamine |
| SMILES | C/N=C/C(C)=C(N)/C(=C/NC(C)C)CN |
| InChI | InChI=1S/C11H22N4/c1-8(2)15-7-10(5-12)11(13)9(3)6-14-4/h6-8,15H,5,12-13H2,1-4H3/b10-7+,11-9-,14-6+ |
| InChIKey | IKDOOGPUHWLVHG-SZRWDVFBSA-N |
| XLogP | 0.76 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|