C16H28N2O — CID 167000989
N-[2-[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]-1-methylpiperidin-4-amine (PubChem CID 167000989) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is N-[2-[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[2-[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 167000989 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | N-[2-[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]-1-methylpiperidin-4-amine |
| SMILES | C[C@@H]1C=C(OCCNC2CCN(C)CC2)C=C[C@@H]1C |
| InChI | InChI=1S/C16H28N2O/c1-13-4-5-16(12-14(13)2)19-11-8-17-15-6-9-18(3)10-7-15/h4-5,12-15,17H,6-11H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | ZEOVVFULEPHPIW-UONOGXRCSA-N |
| XLogP | 2.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|