C20H21N3O4 — CID 167001174
(3S)-3-[7-[(2-methoxyethylamino)methyl]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione (PubChem CID 167001174) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (3S)-3-[7-[(2-methoxyethylamino)methyl]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[7-[(2-methoxyethylamino)methyl]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167001174 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (3S)-3-[7-[(2-methoxyethylamino)methyl]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
| SMILES | COCCNCc1ccc2c(ccc3onc([C@@H]4CCC(=O)NC4=O)c32)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-26-9-8-21-11-12-2-4-14-13(10-12)3-6-16-18(14)19(23-27-16)15-5-7-17(24)22-20(15)25/h2-4,6,10,15,21H,5,7-9,11H2,1H3,(H,22,24,25)/t15-/m0/s1 |
| InChIKey | VYZXUCVLOSIXAE-HNNXBMFYSA-N |
| XLogP | 2.24 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|