About 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole
7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole (PubChem CID 167001268) has the molecular formula C9H5IN2O2
and a molecular weight of 300.06 g/mol. Its IUPAC name is 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole.
Molecular Properties
| Compound Name | 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole |
| PubChem CID | 167001268 |
| Molecular Formula | C9H5IN2O2 |
| Molecular Weight | 300.06 g/mol |
| Exact Mass | 299.94 |
| IUPAC Name | 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole |
| SMILES | Cc1noc2c1ccc1nc(I)oc12 |
| InChI | InChI=1S/C9H5IN2O2/c1-4-5-2-3-6-8(7(5)14-12-4)13-9(10)11-6/h2-3H,1H3 |
| InChIKey | NGEXLNUNCRWRQJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.06 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole?
The IUPAC name of 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole (CID 167001268) is 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole.
What is the SMILES notation for 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole?
The canonical SMILES for 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole is Cc1noc2c1ccc1nc(I)oc12.
What is the InChIKey of 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole?
The InChIKey is NGEXLNUNCRWRQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5IN2O2/c1-4-5-2-3-6-8(7(5)14-12-4)13-9(10)11-6/h2-3H,1H3.
What are the key properties of 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole?
7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole has a molecular weight of 300.06 g/mol, XLogP of 2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-3-methyl-[1,2]oxazolo[4,5-g][1,3]benzoxazole is sourced from PubChem (CID 167001268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).