C15H17FO — CID 167001306
4-[(2E,4E)-5-fluorohepta-2,4,6-trien-2-yl]oxy-1,2-dimethylbenzene (PubChem CID 167001306) has the molecular formula C15H17FO and a molecular weight of 232.30 g/mol. Its IUPAC name is 4-[(2E,4E)-5-fluorohepta-2,4,6-trien-2-yl]oxy-1,2-dimethylbenzene.
| Compound Name | 4-[(2E,4E)-5-fluorohepta-2,4,6-trien-2-yl]oxy-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 167001306 |
| Molecular Formula | C15H17FO |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 4-[(2E,4E)-5-fluorohepta-2,4,6-trien-2-yl]oxy-1,2-dimethylbenzene |
| SMILES | C=C/C(F)=C\C=C(/C)Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H17FO/c1-5-14(16)8-7-13(4)17-15-9-6-11(2)12(3)10-15/h5-10H,1H2,2-4H3/b13-7+,14-8+ |
| InChIKey | LYCPZBINMLNKRB-FNCQTZNRSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|