C12H21NO — CID 167001539
N-[[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine (PubChem CID 167001539) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 167001539 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-[[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCC1=C[C@@H](C)[C@@H](C)C=C1 |
| InChI | InChI=1S/C12H21NO/c1-10-4-5-12(8-11(10)2)9-13-6-7-14-3/h4-5,8,10-11,13H,6-7,9H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | JGOQWUKTEIJQBI-WDEREUQCSA-N |
| XLogP | 1.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|