C6H15NO5S — CID 167001842
1-[2-(2-hydroxyethoxy)ethoxy]-2-(sulfinoamino)ethane (PubChem CID 167001842) has the molecular formula C6H15NO5S and a molecular weight of 213.25 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethoxy]-2-(sulfinoamino)ethane.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethoxy]-2-(sulfinoamino)ethane |
|---|---|
| PubChem CID | 167001842 |
| Molecular Formula | C6H15NO5S |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethoxy]-2-(sulfinoamino)ethane |
| SMILES | O=S(O)NCCOCCOCCO |
| InChI | InChI=1S/C6H15NO5S/c8-2-4-12-6-5-11-3-1-7-13(9)10/h7-8H,1-6H2,(H,9,10) |
| InChIKey | KBYSOKNSIQYUCZ-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|