C16H27N3O2S2 — CID 167001964
(2S)-N-[(4S,7S,9aS)-7-acetyl-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanethioamide (PubChem CID 167001964) has the molecular formula C16H27N3O2S2 and a molecular weight of 357.55 g/mol. Its IUPAC name is (2S)-N-[(4S,7S,9aS)-7-acetyl-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanethioamide.
| Compound Name | (2S)-N-[(4S,7S,9aS)-7-acetyl-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanethioamide |
|---|---|
| PubChem CID | 167001964 |
| Molecular Formula | C16H27N3O2S2 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (2S)-N-[(4S,7S,9aS)-7-acetyl-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanethioamide |
| SMILES | CN[C@@H](C)C(=S)N[C@H]1CCS[C@H]2CC(C)(C)[C@@H](C(C)=O)N2C1=O |
| InChI | InChI=1S/C16H27N3O2S2/c1-9(17-5)14(22)18-11-6-7-23-12-8-16(3,4)13(10(2)20)19(12)15(11)21/h9,11-13,17H,6-8H2,1-5H3,(H,18,22)/t9-,11-,12-,13+/m0/s1 |
| InChIKey | DFZMWEROIRWDPK-XYJRDEOASA-N |
| XLogP | 1.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|