C30H46O2 — CID 167001988
[(2S)-3,4-dimethyl-1-[6-[(2S)-3-methyl-2-phenylbutoxy]hexoxy]pentan-2-yl]benzene (PubChem CID 167001988) has the molecular formula C30H46O2 and a molecular weight of 438.70 g/mol. Its IUPAC name is [(2S)-3,4-dimethyl-1-[6-[(2S)-3-methyl-2-phenylbutoxy]hexoxy]pentan-2-yl]benzene.
| Compound Name | [(2S)-3,4-dimethyl-1-[6-[(2S)-3-methyl-2-phenylbutoxy]hexoxy]pentan-2-yl]benzene |
|---|---|
| PubChem CID | 167001988 |
| Molecular Formula | C30H46O2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | [(2S)-3,4-dimethyl-1-[6-[(2S)-3-methyl-2-phenylbutoxy]hexoxy]pentan-2-yl]benzene |
| SMILES | CC(C)C(C)[C@H](COCCCCCCOC[C@H](c1ccccc1)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H46O2/c1-24(2)26(5)30(28-18-12-9-13-19-28)23-32-21-15-7-6-14-20-31-22-29(25(3)4)27-16-10-8-11-17-27/h8-13,16-19,24-26,29-30H,6-7,14-15,20-23H2,1-5H3/t26?,29-,30-/m0/s1 |
| InChIKey | YDAVXLCHXUUQEM-OGCBTBFQSA-N |
| XLogP | 8.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|