About 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine
1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine (PubChem CID 167002240) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine.
Molecular Properties
| Compound Name | 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine |
| PubChem CID | 167002240 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine |
| SMILES | C=C/C=C\C(=C/C)CN1CCN(CC)CC1 |
| InChI | InChI=1S/C14H24N2/c1-4-7-8-14(5-2)13-16-11-9-15(6-3)10-12-16/h4-5,7-8H,1,6,9-13H2,2-3H3/b8-7-,14-5+ |
| InChIKey | MABCHDLPHNAAOH-KDDHRZGXSA-N |
| XLogP | 2.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine?
The IUPAC name of 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine (CID 167002240) is 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine.
What is the SMILES notation for 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine?
The canonical SMILES for 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine is C=C/C=C\C(=C/C)CN1CCN(CC)CC1.
What is the InChIKey of 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine?
The InChIKey is MABCHDLPHNAAOH-KDDHRZGXSA-N. The full InChI is InChI=1S/C14H24N2/c1-4-7-8-14(5-2)13-16-11-9-15(6-3)10-12-16/h4-5,7-8H,1,6,9-13H2,2-3H3/b8-7-,14-5+.
What are the key properties of 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine?
1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine has a molecular weight of 220.36 g/mol, XLogP of 2.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine is sourced from PubChem (CID 167002240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).