C18H19FN4OS — CID 167002567
4-[(1Z)-3-(5-ethoxy-6-fluoro-1H-indazol-4-yl)buta-1,3-dienyl]-N,5-dimethyl-1,3-thiazol-2-amine (PubChem CID 167002567) has the molecular formula C18H19FN4OS and a molecular weight of 358.44 g/mol. Its IUPAC name is 4-[(1Z)-3-(5-ethoxy-6-fluoro-1H-indazol-4-yl)buta-1,3-dienyl]-N,5-dimethyl-1,3-thiazol-2-amine.
| Compound Name | 4-[(1Z)-3-(5-ethoxy-6-fluoro-1H-indazol-4-yl)buta-1,3-dienyl]-N,5-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 167002567 |
| Molecular Formula | C18H19FN4OS |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 4-[(1Z)-3-(5-ethoxy-6-fluoro-1H-indazol-4-yl)buta-1,3-dienyl]-N,5-dimethyl-1,3-thiazol-2-amine |
| SMILES | C=C(/C=C\c1nc(NC)sc1C)c1c(OCC)c(F)cc2[nH]ncc12 |
| InChI | InChI=1S/C18H19FN4OS/c1-5-24-17-13(19)8-15-12(9-21-23-15)16(17)10(2)6-7-14-11(3)25-18(20-4)22-14/h6-9H,2,5H2,1,3-4H3,(H,20,22)(H,21,23)/b7-6- |
| InChIKey | CYNKWSIBYKXHQR-SREVYHEPSA-N |
| XLogP | 4.63 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|