C9H16F6N2O4S2 — CID 167003100
1,1,1-trifluoro-N-[5-methyl-6-(trifluoromethylsulfonylamino)hexyl]methanesulfonamide (PubChem CID 167003100) has the molecular formula C9H16F6N2O4S2 and a molecular weight of 394.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[5-methyl-6-(trifluoromethylsulfonylamino)hexyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[5-methyl-6-(trifluoromethylsulfonylamino)hexyl]methanesulfonamide |
|---|---|
| PubChem CID | 167003100 |
| Molecular Formula | C9H16F6N2O4S2 |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 1,1,1-trifluoro-N-[5-methyl-6-(trifluoromethylsulfonylamino)hexyl]methanesulfonamide |
| SMILES | CC(CCCCNS(=O)(=O)C(F)(F)F)CNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H16F6N2O4S2/c1-7(6-17-23(20,21)9(13,14)15)4-2-3-5-16-22(18,19)8(10,11)12/h7,16-17H,2-6H2,1H3 |
| InChIKey | GHRMVSGYYMIVSD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|