C23H26N4O3 — CID 167003730
(1R,1aR,7bS)-N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1-methyl-2-oxo-1,1a,3,7b-tetrahydrocyclopropa[c][1,5]naphthyridine-5-carboxamide (PubChem CID 167003730) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is (1R,1aR,7bS)-N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1-methyl-2-oxo-1,1a,3,7b-tetrahydrocyclopropa[c][1,5]naphthyridine-5-carboxamide.
| Compound Name | (1R,1aR,7bS)-N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1-methyl-2-oxo-1,1a,3,7b-tetrahydrocyclopropa[c][1,5]naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 167003730 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (1R,1aR,7bS)-N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1-methyl-2-oxo-1,1a,3,7b-tetrahydrocyclopropa[c][1,5]naphthyridine-5-carboxamide |
| SMILES | C[C@H]1[C@H]2C(=O)Nc3cc(C(=O)NC[C@H](O)CN4CCc5ccccc5C4)cnc3[C@@H]12 |
| InChI | InChI=1S/C23H26N4O3/c1-13-19-20(13)23(30)26-18-8-16(9-24-21(18)19)22(29)25-10-17(28)12-27-7-6-14-4-2-3-5-15(14)11-27/h2-5,8-9,13,17,19-20,28H,6-7,10-12H2,1H3,(H,25,29)(H,26,30)/t13-,17+,19+,20-/m1/s1 |
| InChIKey | IRGUARACLFHJOP-ISHJAKKSSA-N |
| XLogP | 1.53 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |