C10H14O — CID 167003994
5-ethyl-2,3,5,6-tetrahydro-1-benzofuran (PubChem CID 167003994) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 5-ethyl-2,3,5,6-tetrahydro-1-benzofuran.
| Compound Name | 5-ethyl-2,3,5,6-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 167003994 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 5-ethyl-2,3,5,6-tetrahydro-1-benzofuran |
| SMILES | CCC1C=C2CCOC2=CC1 |
| InChI | InChI=1S/C10H14O/c1-2-8-3-4-10-9(7-8)5-6-11-10/h4,7-8H,2-3,5-6H2,1H3 |
| InChIKey | OQUJTUGAUIOFAP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |