About N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide
N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide (PubChem CID 167004004) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide.
Molecular Properties
| Compound Name | N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide |
| PubChem CID | 167004004 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide |
| SMILES | C=N/C(=N\C=C(/C)C(C)(C)C)C1CC1 |
| InChI | InChI=1S/C12H20N2/c1-9(12(2,3)4)8-14-11(13-5)10-6-7-10/h8,10H,5-7H2,1-4H3/b9-8+,14-11- |
| InChIKey | IFDJXUONKZKWRO-LSHJULRISA-N |
| XLogP | 3.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide?
The IUPAC name of N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide (CID 167004004) is N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide.
What is the SMILES notation for N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide?
The canonical SMILES for N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide is C=N/C(=N\C=C(/C)C(C)(C)C)C1CC1.
What is the InChIKey of N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide?
The InChIKey is IFDJXUONKZKWRO-LSHJULRISA-N. The full InChI is InChI=1S/C12H20N2/c1-9(12(2,3)4)8-14-11(13-5)10-6-7-10/h8,10H,5-7H2,1-4H3/b9-8+,14-11-.
What are the key properties of N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide?
N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide has a molecular weight of 192.31 g/mol, XLogP of 3.45, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropanecarboximidamide is sourced from PubChem (CID 167004004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).