C13H22FN — CID 167004090
N-[(1Z,3Z)-8-fluoro-2,5,8-trimethylnona-1,3-dienyl]methanimine (PubChem CID 167004090) has the molecular formula C13H22FN and a molecular weight of 211.32 g/mol. Its IUPAC name is N-[(1Z,3Z)-8-fluoro-2,5,8-trimethylnona-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3Z)-8-fluoro-2,5,8-trimethylnona-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 167004090 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N-[(1Z,3Z)-8-fluoro-2,5,8-trimethylnona-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(C)\C=C/C(C)CCC(C)(C)F |
| InChI | InChI=1S/C13H22FN/c1-11(8-9-13(3,4)14)6-7-12(2)10-15-5/h6-7,10-11H,5,8-9H2,1-4H3/b7-6-,12-10- |
| InChIKey | PIMONELZTODFIS-CEHXRRPISA-N |
| XLogP | 4.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|