C21H26N2OS — CID 167004250
(9R)-9-ethyl-9-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5,7-dimethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-b]quinolin-8-one (PubChem CID 167004250) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is (9R)-9-ethyl-9-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5,7-dimethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-b]quinolin-8-one.
| Compound Name | (9R)-9-ethyl-9-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5,7-dimethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-b]quinolin-8-one |
|---|---|
| PubChem CID | 167004250 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (9R)-9-ethyl-9-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5,7-dimethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-b]quinolin-8-one |
| SMILES | C=C(/C=C\C=C/C)[C@]1(CC)C2=C(Nc3ncsc31)C(C)CC(C)C2=O |
| InChI | InChI=1S/C21H26N2OS/c1-6-8-9-10-15(5)21(7-2)16-17(13(3)11-14(4)18(16)24)23-20-19(21)25-12-22-20/h6,8-10,12-14,23H,5,7,11H2,1-4H3/b8-6-,10-9-/t13?,14?,21-/m1/s1 |
| InChIKey | SSUXSACRPMHRLJ-AYGDSPKSSA-N |
| XLogP | 5.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|