About N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine
N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine (PubChem CID 167004349) has the molecular formula C17H28N2
and a molecular weight of 260.42 g/mol. Its IUPAC name is N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine.
Molecular Properties
| Compound Name | N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine |
| PubChem CID | 167004349 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine |
| SMILES | C=C(C)N(CCCC)C1=CN=C(C2CC(C)C2)CC1 |
| InChI | InChI=1S/C17H28N2/c1-5-6-9-19(13(2)3)16-7-8-17(18-12-16)15-10-14(4)11-15/h12,14-15H,2,5-11H2,1,3-4H3 |
| InChIKey | ZRDRBULQSFMIPB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine?
The IUPAC name of N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine (CID 167004349) is N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine.
What is the SMILES notation for N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine?
The canonical SMILES for N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine is C=C(C)N(CCCC)C1=CN=C(C2CC(C)C2)CC1.
What is the InChIKey of N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine?
The InChIKey is ZRDRBULQSFMIPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2/c1-5-6-9-19(13(2)3)16-7-8-17(18-12-16)15-10-14(4)11-15/h12,14-15H,2,5-11H2,1,3-4H3.
What are the key properties of N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine?
N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine has a molecular weight of 260.42 g/mol, XLogP of 4.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-(3-methylcyclobutyl)-N-prop-1-en-2-yl-3,4-dihydropyridin-5-amine is sourced from PubChem (CID 167004349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).