C17H20N2 — CID 167004794
5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrazole (PubChem CID 167004794) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrazole.
| Compound Name | 5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrazole |
|---|---|
| PubChem CID | 167004794 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrazole |
| SMILES | C=C/C=C(\C=C/C)n1nccc1/C(C=C)=C/C=C\C |
| InChI | InChI=1S/C17H20N2/c1-5-9-12-15(8-4)17-13-14-18-19(17)16(10-6-2)11-7-3/h5-14H,2,4H2,1,3H3/b9-5-,11-7-,15-12+,16-10+ |
| InChIKey | IWZXMUPXHAJBBW-AIGFAALLSA-N |
| XLogP | 4.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|