C23H38O4 — CID 167004857
2-(5-ethyl-4,5-dimethyldecan-2-yl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 167004857) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is 2-(5-ethyl-4,5-dimethyldecan-2-yl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(5-ethyl-4,5-dimethyldecan-2-yl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 167004857 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 2-(5-ethyl-4,5-dimethyldecan-2-yl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCC(C)(CC)C(C)CC(C)C1=C(C)C(=O)C(OC)=C(OC)C1=O |
| InChI | InChI=1S/C23H38O4/c1-9-11-12-13-23(6,10-2)16(4)14-15(3)18-17(5)19(24)21(26-7)22(27-8)20(18)25/h15-16H,9-14H2,1-8H3 |
| InChIKey | VTPNXCQKYVTFHT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|