C23H22N4O2S — CID 167004909
(E)-1-(5-benzyl-1H-1,2,4-triazol-3-yl)-4-[(3S)-5-methyl-4-sulfanylidene-2,3-dihydro-1,5-benzoxazepin-3-yl]but-3-en-1-one (PubChem CID 167004909) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is (E)-1-(5-benzyl-1H-1,2,4-triazol-3-yl)-4-[(3S)-5-methyl-4-sulfanylidene-2,3-dihydro-1,5-benzoxazepin-3-yl]but-3-en-1-one.
| Compound Name | (E)-1-(5-benzyl-1H-1,2,4-triazol-3-yl)-4-[(3S)-5-methyl-4-sulfanylidene-2,3-dihydro-1,5-benzoxazepin-3-yl]but-3-en-1-one |
|---|---|
| PubChem CID | 167004909 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (E)-1-(5-benzyl-1H-1,2,4-triazol-3-yl)-4-[(3S)-5-methyl-4-sulfanylidene-2,3-dihydro-1,5-benzoxazepin-3-yl]but-3-en-1-one |
| SMILES | CN1C(=S)[C@@H](/C=C/CC(=O)c2n[nH]c(Cc3ccccc3)n2)COc2ccccc21 |
| InChI | InChI=1S/C23H22N4O2S/c1-27-18-11-5-6-13-20(18)29-15-17(23(27)30)10-7-12-19(28)22-24-21(25-26-22)14-16-8-3-2-4-9-16/h2-11,13,17H,12,14-15H2,1H3,(H,24,25,26)/b10-7+/t17-/m0/s1 |
| InChIKey | ZLDOGTBHFVYBDI-JEJOPICUSA-N |
| XLogP | 4.00 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|