C11H16F3NO — CID 167004938
3-(6,6,6-trifluoro-2,2-dimethylhexan-3-yl)-1,2-oxazole (PubChem CID 167004938) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is 3-(6,6,6-trifluoro-2,2-dimethylhexan-3-yl)-1,2-oxazole.
| Compound Name | 3-(6,6,6-trifluoro-2,2-dimethylhexan-3-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 167004938 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-(6,6,6-trifluoro-2,2-dimethylhexan-3-yl)-1,2-oxazole |
| SMILES | CC(C)(C)C(CCC(F)(F)F)c1ccon1 |
| InChI | InChI=1S/C11H16F3NO/c1-10(2,3)8(4-6-11(12,13)14)9-5-7-16-15-9/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | BEAQCYSGDUIZAH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |