C35H69NO — CID 167005725
3,3-dimethyl-4-(pentadecan-8-ylamino)-6-pentyltridec-1-en-5-one (PubChem CID 167005725) has the molecular formula C35H69NO and a molecular weight of 519.94 g/mol. Its IUPAC name is 3,3-dimethyl-4-(pentadecan-8-ylamino)-6-pentyltridec-1-en-5-one.
| Compound Name | 3,3-dimethyl-4-(pentadecan-8-ylamino)-6-pentyltridec-1-en-5-one |
|---|---|
| PubChem CID | 167005725 |
| Molecular Formula | C35H69NO |
| Molecular Weight | 519.94 g/mol |
| Exact Mass | 519.54 |
| IUPAC Name | 3,3-dimethyl-4-(pentadecan-8-ylamino)-6-pentyltridec-1-en-5-one |
| SMILES | C=CC(C)(C)C(NC(CCCCCCC)CCCCCCC)C(=O)C(CCCCC)CCCCCCC |
| InChI | InChI=1S/C35H69NO/c1-8-13-17-20-24-28-31(27-23-16-11-4)33(37)34(35(6,7)12-5)36-32(29-25-21-18-14-9-2)30-26-22-19-15-10-3/h12,31-32,34,36H,5,8-11,13-30H2,1-4,6-7H3 |
| InChIKey | UATGJBYGAWCUIS-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.94 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|