C51H39N3 — CID 167005933
(2R)-4-[3-[3,5-bis(4-phenylphenyl)phenyl]phenyl]-6-[(3E)-hexa-1,3,5-trien-3-yl]-2-phenyl-1,2-dihydro-1,3,5-triazine (PubChem CID 167005933) has the molecular formula C51H39N3 and a molecular weight of 693.89 g/mol. Its IUPAC name is (2R)-4-[3-[3,5-bis(4-phenylphenyl)phenyl]phenyl]-6-[(3E)-hexa-1,3,5-trien-3-yl]-2-phenyl-1,2-dihydro-1,3,5-triazine.
| Compound Name | (2R)-4-[3-[3,5-bis(4-phenylphenyl)phenyl]phenyl]-6-[(3E)-hexa-1,3,5-trien-3-yl]-2-phenyl-1,2-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 167005933 |
| Molecular Formula | C51H39N3 |
| Molecular Weight | 693.89 g/mol |
| Exact Mass | 693.31 |
| IUPAC Name | (2R)-4-[3-[3,5-bis(4-phenylphenyl)phenyl]phenyl]-6-[(3E)-hexa-1,3,5-trien-3-yl]-2-phenyl-1,2-dihydro-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C)C1=NC(c2cccc(-c3cc(-c4ccc(-c5ccccc5)cc4)cc(-c4ccc(-c5ccccc5)cc4)c3)c2)=N[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C51H39N3/c1-3-15-36(4-2)49-52-50(43-20-12-7-13-21-43)54-51(53-49)45-23-14-22-44(32-45)48-34-46(41-28-24-39(25-29-41)37-16-8-5-9-17-37)33-47(35-48)42-30-26-40(27-31-42)38-18-10-6-11-19-38/h3-35,50H,1-2H2,(H,52,53,54)/b36-15+/t50-/m1/s1 |
| InChIKey | BMAUDCKDWHAGKD-URKAYQAFSA-N |
| XLogP | 12.77 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.89 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|