C27H31N3O3 — CID 167006152
5-[[(2S)-2-(dihydroxymethyl)piperidin-1-yl]methyl]-6-methyl-N-(2-methyl-3-phenylphenyl)pyridine-2-carboxamide (PubChem CID 167006152) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is 5-[[(2S)-2-(dihydroxymethyl)piperidin-1-yl]methyl]-6-methyl-N-(2-methyl-3-phenylphenyl)pyridine-2-carboxamide.
| Compound Name | 5-[[(2S)-2-(dihydroxymethyl)piperidin-1-yl]methyl]-6-methyl-N-(2-methyl-3-phenylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167006152 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 5-[[(2S)-2-(dihydroxymethyl)piperidin-1-yl]methyl]-6-methyl-N-(2-methyl-3-phenylphenyl)pyridine-2-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2cccc(-c3ccccc3)c2C)ccc1CN1CCCC[C@H]1C(O)O |
| InChI | InChI=1S/C27H31N3O3/c1-18-22(20-9-4-3-5-10-20)11-8-12-23(18)29-26(31)24-15-14-21(19(2)28-24)17-30-16-7-6-13-25(30)27(32)33/h3-5,8-12,14-15,25,27,32-33H,6-7,13,16-17H2,1-2H3,(H,29,31)/t25-/m0/s1 |
| InChIKey | QYUJLQXQXJWRJW-VWLOTQADSA-N |
| XLogP | 4.28 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|