C8H8F3NO2 — CID 167006313
(Z,2E)-2-ethylidene-5,5,5-trifluoro-4-(methylideneamino)pent-3-enoic acid (PubChem CID 167006313) has the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-5,5,5-trifluoro-4-(methylideneamino)pent-3-enoic acid.
| Compound Name | (Z,2E)-2-ethylidene-5,5,5-trifluoro-4-(methylideneamino)pent-3-enoic acid |
|---|---|
| PubChem CID | 167006313 |
| Molecular Formula | C8H8F3NO2 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (Z,2E)-2-ethylidene-5,5,5-trifluoro-4-(methylideneamino)pent-3-enoic acid |
| SMILES | C=N/C(=C\C(=C/C)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO2/c1-3-5(7(13)14)4-6(12-2)8(9,10)11/h3-4H,2H2,1H3,(H,13,14)/b5-3+,6-4- |
| InChIKey | WCYCDYNLBWKOFG-UZNMPDEFSA-N |
| XLogP | 2.16 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|