C14H25FN2 — CID 167006446
(2E)-2-(1-fluoroethylidene)-1-N-methyl-3-N-[(1Z,3E)-penta-1,3-dienyl]hexane-1,3-diamine (PubChem CID 167006446) has the molecular formula C14H25FN2 and a molecular weight of 240.37 g/mol. Its IUPAC name is (2E)-2-(1-fluoroethylidene)-1-N-methyl-3-N-[(1Z,3E)-penta-1,3-dienyl]hexane-1,3-diamine.
| Compound Name | (2E)-2-(1-fluoroethylidene)-1-N-methyl-3-N-[(1Z,3E)-penta-1,3-dienyl]hexane-1,3-diamine |
|---|---|
| PubChem CID | 167006446 |
| Molecular Formula | C14H25FN2 |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | (2E)-2-(1-fluoroethylidene)-1-N-methyl-3-N-[(1Z,3E)-penta-1,3-dienyl]hexane-1,3-diamine |
| SMILES | C/C=C/C=C\NC(CCC)/C(CNC)=C(\C)F |
| InChI | InChI=1S/C14H25FN2/c1-5-7-8-10-17-14(9-6-2)13(11-16-4)12(3)15/h5,7-8,10,14,16-17H,6,9,11H2,1-4H3/b7-5+,10-8-,13-12+ |
| InChIKey | IAPMDEFLEGETHC-GKLDWVADSA-N |
| XLogP | 3.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|