C18H24ClNO3S — CID 167006609
(3S)-3-(2-chloro-4-methylsulfonylphenyl)-4-(4-methylpenta-1,3-dien-2-yl)-1,4-oxazepane (PubChem CID 167006609) has the molecular formula C18H24ClNO3S and a molecular weight of 369.91 g/mol. Its IUPAC name is (3S)-3-(2-chloro-4-methylsulfonylphenyl)-4-(4-methylpenta-1,3-dien-2-yl)-1,4-oxazepane.
| Compound Name | (3S)-3-(2-chloro-4-methylsulfonylphenyl)-4-(4-methylpenta-1,3-dien-2-yl)-1,4-oxazepane |
|---|---|
| PubChem CID | 167006609 |
| Molecular Formula | C18H24ClNO3S |
| Molecular Weight | 369.91 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (3S)-3-(2-chloro-4-methylsulfonylphenyl)-4-(4-methylpenta-1,3-dien-2-yl)-1,4-oxazepane |
| SMILES | C=C(C=C(C)C)N1CCCOC[C@@H]1c1ccc(S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C18H24ClNO3S/c1-13(2)10-14(3)20-8-5-9-23-12-18(20)16-7-6-15(11-17(16)19)24(4,21)22/h6-7,10-11,18H,3,5,8-9,12H2,1-2,4H3/t18-/m1/s1 |
| InChIKey | DPEUKXMSSMIQQY-GOSISDBHSA-N |
| XLogP | 3.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.91 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|