C46H31N3O — CID 167007150
(E)-3-[12-[(2,3-diphenylcyclopropylidene)methyl]-15-oxo-4,6-diphenyl-11,14-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5,7,9(16),10,12-heptaen-13-yl]-2-methylprop-2-enenitrile (PubChem CID 167007150) has the molecular formula C46H31N3O and a molecular weight of 641.77 g/mol. Its IUPAC name is (E)-3-[12-[(2,3-diphenylcyclopropylidene)methyl]-15-oxo-4,6-diphenyl-11,14-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5,7,9(16),10,12-heptaen-13-yl]-2-methylprop-2-enenitrile.
| Compound Name | (E)-3-[12-[(2,3-diphenylcyclopropylidene)methyl]-15-oxo-4,6-diphenyl-11,14-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5,7,9(16),10,12-heptaen-13-yl]-2-methylprop-2-enenitrile |
|---|---|
| PubChem CID | 167007150 |
| Molecular Formula | C46H31N3O |
| Molecular Weight | 641.77 g/mol |
| Exact Mass | 641.25 |
| IUPAC Name | (E)-3-[12-[(2,3-diphenylcyclopropylidene)methyl]-15-oxo-4,6-diphenyl-11,14-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5,7,9(16),10,12-heptaen-13-yl]-2-methylprop-2-enenitrile |
| SMILES | C/C(C#N)=C\c1c(C=C2C(c3ccccc3)C2c2ccccc2)nc2c3ccc(-c4ccccc4)c4c(-c5ccccc5)ccc(c(=O)n12)c43 |
| InChI | InChI=1S/C46H31N3O/c1-29(28-47)26-40-39(27-38-41(32-18-10-4-11-19-32)42(38)33-20-12-5-13-21-33)48-45-36-24-22-34(30-14-6-2-7-15-30)43-35(31-16-8-3-9-17-31)23-25-37(44(36)43)46(50)49(40)45/h2-27,41-42H,1H3/b29-26+,38-27? |
| InChIKey | GUHAAEILVTYIKP-CVBRLASZSA-N |
| XLogP | 10.66 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.77 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|