C39H25N3O — CID 167007593
2-(6,7-Dihydrodibenzofuran-1-yl)-4-naphthalen-2-yl-6-phenanthren-9-yl-1,3,5-triazine (PubChem CID 167007593) has the molecular formula C39H25N3O and a molecular weight of 551.60 g/mol. Its IUPAC name is 2-(6,7-dihydrodibenzofuran-1-yl)-4-naphthalen-2-yl-6-phenanthren-9-yl-1,3,5-triazine.
| Compound Name | 2-(6,7-Dihydrodibenzofuran-1-yl)-4-naphthalen-2-yl-6-phenanthren-9-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 167007593 |
| Molecular Formula | C39H25N3O |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 2-(6,7-dihydrodibenzofuran-1-yl)-4-naphthalen-2-yl-6-phenanthren-9-yl-1,3,5-triazine |
| SMILES | C1CC2=C(C=C1)C3=C(C=CC=C3O2)C4=NC(=NC(=N4)C5=CC6=CC=CC=C6C=C5)C7=CC8=CC=CC=C8C9=CC=CC=C97 |
| InChI | InChI=1S/C39H25N3O/c1-2-11-25-22-27(21-20-24(25)10-1)37-40-38(32-17-9-19-35-36(32)31-16-7-8-18-34(31)43-35)42-39(41-37)33-23-26-12-3-4-13-28(26)29-14-5-6-15-30(29)33/h1-7,9-17,19-23H,8,18H2 |
| InChIKey | GEFVWVWXWRMTFT-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | 999 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|