C30H32O6 — CID 167007862
(4S)-3-(2,3-dihydro-1H-inden-2-yloxymethoxymethyl)-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylic acid (PubChem CID 167007862) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is (4S)-3-(2,3-dihydro-1H-inden-2-yloxymethoxymethyl)-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | (4S)-3-(2,3-dihydro-1H-inden-2-yloxymethoxymethyl)-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 167007862 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | (4S)-3-(2,3-dihydro-1H-inden-2-yloxymethoxymethyl)-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylic acid |
| SMILES | COc1ccccc1C1C(COCOC2Cc3ccccc3C2)[C@H](c2ccccc2OC)C1C(=O)O |
| InChI | InChI=1S/C30H32O6/c1-33-25-13-7-5-11-22(25)27-24(17-35-18-36-21-15-19-9-3-4-10-20(19)16-21)28(29(27)30(31)32)23-12-6-8-14-26(23)34-2/h3-14,21,24,27-29H,15-18H2,1-2H3,(H,31,32)/t24?,27-,28?,29?/m0/s1 |
| InChIKey | WBZQOOLYOWQOJH-ANSVBVDISA-N |
| XLogP | 5.06 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|