C54H35N3O2 — CID 167008260
2-[4-[7-[4-[(1Z)-buta-1,3-dienyl]-3-methylphenyl]dibenzofuran-1-yl]naphthalen-1-yl]-4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazine (PubChem CID 167008260) has the molecular formula C54H35N3O2 and a molecular weight of 757.89 g/mol. Its IUPAC name is 2-[4-[7-[4-[(1Z)-buta-1,3-dienyl]-3-methylphenyl]dibenzofuran-1-yl]naphthalen-1-yl]-4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[4-[7-[4-[(1Z)-buta-1,3-dienyl]-3-methylphenyl]dibenzofuran-1-yl]naphthalen-1-yl]-4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 167008260 |
| Molecular Formula | C54H35N3O2 |
| Molecular Weight | 757.89 g/mol |
| Exact Mass | 757.27 |
| IUPAC Name | 2-[4-[7-[4-[(1Z)-buta-1,3-dienyl]-3-methylphenyl]dibenzofuran-1-yl]naphthalen-1-yl]-4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C=C\c1ccc(-c2ccc3c(c2)oc2cccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6cccc7c6oc6ccccc67)n5)c5ccccc45)c23)cc1C |
| InChI | InChI=1S/C54H35N3O2/c1-3-4-14-34-25-26-36(31-33(34)2)37-27-28-45-49(32-37)58-48-24-13-20-42(50(45)48)40-29-30-44(39-18-9-8-17-38(39)40)53-55-52(35-15-6-5-7-16-35)56-54(57-53)46-22-12-21-43-41-19-10-11-23-47(41)59-51(43)46/h3-32H,1H2,2H3/b14-4- |
| InChIKey | FQUPEHIATWAZJY-CPSFFCFKSA-N |
| XLogP | 14.67 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.89 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|