C21H24N4O4 — CID 167008521
2-N-[5-(methylamino)-1,5-dioxopentan-2-yl]-5-N-(1-phenylethyl)pyridine-2,5-dicarboxamide (PubChem CID 167008521) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-N-[5-(methylamino)-1,5-dioxopentan-2-yl]-5-N-(1-phenylethyl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-[5-(methylamino)-1,5-dioxopentan-2-yl]-5-N-(1-phenylethyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 167008521 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-N-[5-(methylamino)-1,5-dioxopentan-2-yl]-5-N-(1-phenylethyl)pyridine-2,5-dicarboxamide |
| SMILES | CNC(=O)CCC(C=O)NC(=O)c1ccc(C(=O)NC(C)c2ccccc2)cn1 |
| InChI | InChI=1S/C21H24N4O4/c1-14(15-6-4-3-5-7-15)24-20(28)16-8-10-18(23-12-16)21(29)25-17(13-26)9-11-19(27)22-2/h3-8,10,12-14,17H,9,11H2,1-2H3,(H,22,27)(H,24,28)(H,25,29) |
| InChIKey | QSZMKDNXZKFSEM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|